C13H16N2 — CID 118965636
N-[(2E,4E)-2-(ethylideneamino)-4-methylhepta-2,4,6-trien-3-yl]prop-2-yn-1-imine (PubChem CID 118965636) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is N-[(2E,4E)-2-(ethylideneamino)-4-methylhepta-2,4,6-trien-3-yl]prop-2-yn-1-imine.
| Compound Name | N-[(2E,4E)-2-(ethylideneamino)-4-methylhepta-2,4,6-trien-3-yl]prop-2-yn-1-imine |
|---|---|
| PubChem CID | 118965636 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-[(2E,4E)-2-(ethylideneamino)-4-methylhepta-2,4,6-trien-3-yl]prop-2-yn-1-imine |
| SMILES | C#C/C=N/C(/C(C)=C/C=C)=C(C)/N=C/C |
| InChI | InChI=1S/C13H16N2/c1-6-9-11(4)13(15-10-7-2)12(5)14-8-3/h2,6,8-10H,1H2,3-5H3/b11-9+,13-12+,14-8+,15-10+ |
| InChIKey | JUBVQKKVJHPXMZ-USPKTXJRSA-N |
| XLogP | 3.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|