C10H11ClNO4S- — CID 118965966
2-chloro-5-[2-hydroxyethyl(methyl)carbamoyl]benzenesulfinate (PubChem CID 118965966) has the molecular formula C10H11ClNO4S- and a molecular weight of 276.72 g/mol. Its IUPAC name is 2-chloro-5-[2-hydroxyethyl(methyl)carbamoyl]benzenesulfinate.
| Compound Name | 2-chloro-5-[2-hydroxyethyl(methyl)carbamoyl]benzenesulfinate |
|---|---|
| PubChem CID | 118965966 |
| Molecular Formula | C10H11ClNO4S- |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2-chloro-5-[2-hydroxyethyl(methyl)carbamoyl]benzenesulfinate |
| SMILES | CN(CCO)C(=O)c1ccc(Cl)c(S(=O)[O-])c1 |
| InChI | InChI=1S/C10H12ClNO4S/c1-12(4-5-13)10(14)7-2-3-8(11)9(6-7)17(15)16/h2-3,6,13H,4-5H2,1H3,(H,15,16)/p-1 |
| InChIKey | GBISKFZTALKSAZ-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|