C14H16Cl2FN3O — CID 118966313
4-chloro-7-[(3R,4R,5R)-3-chloro-5-ethyl-3,4-dimethyloxolan-2-yl]-5-fluoropyrrolo[2,3-d]pyrimidine (PubChem CID 118966313) has the molecular formula C14H16Cl2FN3O and a molecular weight of 332.21 g/mol. Its IUPAC name is 4-chloro-7-[(3R,4R,5R)-3-chloro-5-ethyl-3,4-dimethyloxolan-2-yl]-5-fluoropyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-chloro-7-[(3R,4R,5R)-3-chloro-5-ethyl-3,4-dimethyloxolan-2-yl]-5-fluoropyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 118966313 |
| Molecular Formula | C14H16Cl2FN3O |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 4-chloro-7-[(3R,4R,5R)-3-chloro-5-ethyl-3,4-dimethyloxolan-2-yl]-5-fluoropyrrolo[2,3-d]pyrimidine |
| SMILES | CC[C@H]1OC(n2cc(F)c3c(Cl)ncnc32)[C@](C)(Cl)[C@@H]1C |
| InChI | InChI=1S/C14H16Cl2FN3O/c1-4-9-7(2)14(3,16)13(21-9)20-5-8(17)10-11(15)18-6-19-12(10)20/h5-7,9,13H,4H2,1-3H3/t7-,9-,13?,14-/m1/s1 |
| InChIKey | CNTAJYOYFBPDCT-NUTGARJGSA-N |
| XLogP | 4.16 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|