C15H21N5O — CID 118966778
11-(cyclohexylmethyl)-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one (PubChem CID 118966778) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 11-(cyclohexylmethyl)-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one.
| Compound Name | 11-(cyclohexylmethyl)-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 118966778 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 11-(cyclohexylmethyl)-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
| SMILES | O=c1c2cn[nH]c2nc2n1CCN(CC1CCCCC1)C2 |
| InChI | InChI=1S/C15H21N5O/c21-15-12-8-16-18-14(12)17-13-10-19(6-7-20(13)15)9-11-4-2-1-3-5-11/h8,11H,1-7,9-10H2,(H,16,18) |
| InChIKey | LIUHMCUPAWGKQG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |