C24H30N2O3 — CID 11896713
N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-N'-(4-phenoxyphenyl)butanediamide (PubChem CID 11896713) has the molecular formula C24H30N2O3 and a molecular weight of 394.51 g/mol. Its IUPAC name is N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-N'-(4-phenoxyphenyl)butanediamide.
| Compound Name | N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-N'-(4-phenoxyphenyl)butanediamide |
|---|---|
| PubChem CID | 11896713 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-N'-(4-phenoxyphenyl)butanediamide |
| SMILES | C[C@H]1[C@@H](NC(=O)CCC(=O)Nc2ccc(Oc3ccccc3)cc2)CCC[C@@H]1C |
| InChI | InChI=1S/C24H30N2O3/c1-17-7-6-10-22(18(17)2)26-24(28)16-15-23(27)25-19-11-13-21(14-12-19)29-20-8-4-3-5-9-20/h3-5,8-9,11-14,17-18,22H,6-7,10,15-16H2,1-2H3,(H,25,27)(H,26,28)/t17-,18+,22-/m0/s1 |
| InChIKey | MYNCPRYCNHJTKD-SVMVAKDDSA-N |
| XLogP | 5.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |