C10H15N3O — CID 118967289
4-(2,5-dimethylhex-3-yn-2-yl)-1H-1,2,4-triazol-5-one (PubChem CID 118967289) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(2,5-dimethylhex-3-yn-2-yl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-(2,5-dimethylhex-3-yn-2-yl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 118967289 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 4-(2,5-dimethylhex-3-yn-2-yl)-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)C#CC(C)(C)n1cn[nH]c1=O |
| InChI | InChI=1S/C10H15N3O/c1-8(2)5-6-10(3,4)13-7-11-12-9(13)14/h7-8H,1-4H3,(H,12,14) |
| InChIKey | QGYBPNWKGJGYLG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|