C13H19F2N3 — CID 118967305
(2S,4R)-7-tert-butyl-5,5-difluoro-N,N-dimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-9-amine (PubChem CID 118967305) has the molecular formula C13H19F2N3 and a molecular weight of 255.31 g/mol. Its IUPAC name is (2S,4R)-7-tert-butyl-5,5-difluoro-N,N-dimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-9-amine.
| Compound Name | (2S,4R)-7-tert-butyl-5,5-difluoro-N,N-dimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-9-amine |
|---|---|
| PubChem CID | 118967305 |
| Molecular Formula | C13H19F2N3 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | (2S,4R)-7-tert-butyl-5,5-difluoro-N,N-dimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-9-amine |
| SMILES | CN(C)c1nn(C(C)(C)C)c2c1[C@H]1C[C@H]1C2(F)F |
| InChI | InChI=1S/C13H19F2N3/c1-12(2,3)18-10-9(11(16-18)17(4)5)7-6-8(7)13(10,14)15/h7-8H,6H2,1-5H3/t7-,8+/m0/s1 |
| InChIKey | OOZCTDJLJHMXAC-JGVFFNPUSA-N |
| XLogP | 2.91 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |