C13H12OS — CID 118967521
2-(1-propa-1,2-dienoxyethyl)-1-benzothiophene (PubChem CID 118967521) has the molecular formula C13H12OS and a molecular weight of 216.30 g/mol. Its IUPAC name is 2-(1-propa-1,2-dienoxyethyl)-1-benzothiophene.
| Compound Name | 2-(1-propa-1,2-dienoxyethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 118967521 |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-(1-propa-1,2-dienoxyethyl)-1-benzothiophene |
| SMILES | C=C=COC(C)c1cc2ccccc2s1 |
| InChI | InChI=1S/C13H12OS/c1-3-8-14-10(2)13-9-11-6-4-5-7-12(11)15-13/h4-10H,1H2,2H3 |
| InChIKey | PUTQXVNNYSPXLF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|