C50H46F6O4S2 — CID 118967717
3,3,4,4,5,5-hexafluoro-9,12,12,15-tetrakis(4-methoxy-3,5-dimethylphenyl)-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaene (PubChem CID 118967717) has the molecular formula C50H46F6O4S2 and a molecular weight of 889.04 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-9,12,12,15-tetrakis(4-methoxy-3,5-dimethylphenyl)-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-9,12,12,15-tetrakis(4-methoxy-3,5-dimethylphenyl)-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaene |
|---|---|
| PubChem CID | 118967717 |
| Molecular Formula | C50H46F6O4S2 |
| Molecular Weight | 889.04 g/mol |
| Exact Mass | 888.27 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-9,12,12,15-tetrakis(4-methoxy-3,5-dimethylphenyl)-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaene |
| SMILES | COc1c(C)cc(-c2cc3c(s2)C(c2cc(C)c(OC)c(C)c2)(c2cc(C)c(OC)c(C)c2)c2sc(-c4cc(C)c(OC)c(C)c4)cc2C2=C3C(F)(F)C(F)(F)C2(F)F)cc1C |
| InChI | InChI=1S/C50H46F6O4S2/c1-23-13-31(14-24(2)41(23)57-9)37-21-35-39-40(49(53,54)50(55,56)48(39,51)52)36-22-38(32-15-25(3)42(58-10)26(4)16-32)62-46(36)47(45(35)61-37,33-17-27(5)43(59-11)28(6)18-33)34-19-29(7)44(60-12)30(8)20-34/h13-22H,1-12H3 |
| InChIKey | UVACCCKSIPJQPX-UHFFFAOYSA-N |
| XLogP | 14.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.04 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|