C48H40F6OS2 — CID 118967733
1-[4-[12,12-bis(4-tert-butylphenyl)-3,3,4,4,5,5-hexafluoro-15-phenyl-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaen-9-yl]phenyl]ethanone (PubChem CID 118967733) has the molecular formula C48H40F6OS2 and a molecular weight of 810.97 g/mol. Its IUPAC name is 1-[4-[12,12-bis(4-tert-butylphenyl)-3,3,4,4,5,5-hexafluoro-15-phenyl-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaen-9-yl]phenyl]ethanone.
| Compound Name | 1-[4-[12,12-bis(4-tert-butylphenyl)-3,3,4,4,5,5-hexafluoro-15-phenyl-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaen-9-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 118967733 |
| Molecular Formula | C48H40F6OS2 |
| Molecular Weight | 810.97 g/mol |
| Exact Mass | 810.24 |
| IUPAC Name | 1-[4-[12,12-bis(4-tert-butylphenyl)-3,3,4,4,5,5-hexafluoro-15-phenyl-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaen-9-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2cc3c(s2)C(c2ccc(C(C)(C)C)cc2)(c2ccc(C(C)(C)C)cc2)c2sc(-c4ccccc4)cc2C2=C3C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C48H40F6OS2/c1-27(55)28-13-15-30(16-14-28)38-26-36-40-39(46(49,50)48(53,54)47(40,51)52)35-25-37(29-11-9-8-10-12-29)56-41(35)45(42(36)57-38,33-21-17-31(18-22-33)43(2,3)4)34-23-19-32(20-24-34)44(5,6)7/h8-26H,1-7H3 |
| InChIKey | XHISGWCPJJXPCG-UHFFFAOYSA-N |
| XLogP | 14.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.97 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|