C23H18F3NO6S2 — CID 118968471
[6-[2-(2,4-dimethylphenoxy)ethylsulfanyl]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate (PubChem CID 118968471) has the molecular formula C23H18F3NO6S2 and a molecular weight of 525.53 g/mol. Its IUPAC name is [6-[2-(2,4-dimethylphenoxy)ethylsulfanyl]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-[2-(2,4-dimethylphenoxy)ethylsulfanyl]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118968471 |
| Molecular Formula | C23H18F3NO6S2 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | [6-[2-(2,4-dimethylphenoxy)ethylsulfanyl]-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(OCCSc2ccc3c4c(cccc24)C(=O)N(OS(=O)(=O)C(F)(F)F)C3=O)c(C)c1 |
| InChI | InChI=1S/C23H18F3NO6S2/c1-13-6-8-18(14(2)12-13)32-10-11-34-19-9-7-17-20-15(19)4-3-5-16(20)21(28)27(22(17)29)33-35(30,31)23(24,25)26/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | NJXOAXWLVVDXDY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|