About (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate
(1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate (PubChem CID 118968487) has the molecular formula C22H19NO5S2
and a molecular weight of 441.53 g/mol. Its IUPAC name is (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate |
| PubChem CID | 118968487 |
| Molecular Formula | C22H19NO5S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON2C(=O)c3cccc4c(SC(C)C)ccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C22H19NO5S2/c1-13(2)29-19-12-11-18-20-16(19)5-4-6-17(20)21(24)23(22(18)25)28-30(26,27)15-9-7-14(3)8-10-15/h4-13H,1-3H3 |
| InChIKey | RGLCUHGJDWMMAM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate?
The IUPAC name of (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate (CID 118968487) is (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate.
What is the SMILES notation for (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate?
The canonical SMILES for (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)ON2C(=O)c3cccc4c(SC(C)C)ccc(c34)C2=O)cc1.
What is the InChIKey of (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate?
The InChIKey is RGLCUHGJDWMMAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO5S2/c1-13(2)29-19-12-11-18-20-16(19)5-4-6-17(20)21(24)23(22(18)25)28-30(26,27)15-9-7-14(3)8-10-15/h4-13H,1-3H3.
What are the key properties of (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate?
(1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate has a molecular weight of 441.53 g/mol, XLogP of 4.57, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate is sourced from PubChem (CID 118968487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).