About 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate
2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate (PubChem CID 118968527) has the molecular formula C23H19NO7S2
and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate.
Molecular Properties
| Compound Name | 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate |
| PubChem CID | 118968527 |
| Molecular Formula | C23H19NO7S2 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCCSc1ccc2c3c(cccc13)C(=O)N(OS(C)(=O)=O)C2=O |
| InChI | InChI=1S/C23H19NO7S2/c1-14-6-3-4-7-15(14)23(27)30-12-13-32-19-11-10-18-20-16(19)8-5-9-17(20)21(25)24(22(18)26)31-33(2,28)29/h3-11H,12-13H2,1-2H3 |
| InChIKey | IMLJYSJGWWLJQU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate?
The IUPAC name of 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate (CID 118968527) is 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate.
What is the SMILES notation for 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate?
The canonical SMILES for 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate is Cc1ccccc1C(=O)OCCSc1ccc2c3c(cccc13)C(=O)N(OS(C)(=O)=O)C2=O.
What is the InChIKey of 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate?
The InChIKey is IMLJYSJGWWLJQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO7S2/c1-14-6-3-4-7-15(14)23(27)30-12-13-32-19-11-10-18-20-16(19)8-5-9-17(20)21(25)24(22(18)26)31-33(2,28)29/h3-11H,12-13H2,1-2H3.
What are the key properties of 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate?
2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate has a molecular weight of 485.54 g/mol, XLogP of 3.58, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylsulfonyloxy-1,3-dioxobenzo[de]isoquinolin-6-yl)sulfanylethyl 2-methylbenzoate is sourced from PubChem (CID 118968527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).