About 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one
2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 118968625) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one |
| PubChem CID | 118968625 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | O=C1OC2C(OCC3CO3)C3CC1C2O3 |
| InChI | InChI=1S/C10H12O5/c11-10-5-1-6-8(13-3-4-2-12-4)9(15-10)7(5)14-6/h4-9H,1-3H2 |
| InChIKey | NPMIAGIMZFOFDK-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The IUPAC name of 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one (CID 118968625) is 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one.
What is the SMILES notation for 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The canonical SMILES for 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one is O=C1OC2C(OCC3CO3)C3CC1C2O3.
What is the InChIKey of 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The InChIKey is NPMIAGIMZFOFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5/c11-10-5-1-6-8(13-3-4-2-12-4)9(15-10)7(5)14-6/h4-9H,1-3H2.
What are the key properties of 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one has a molecular weight of 212.20 g/mol, XLogP of -0.52, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one is sourced from PubChem (CID 118968625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).