C26H27F3N8O — CID 118968949
N-(4-piperazin-1-ylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118968949) has the molecular formula C26H27F3N8O and a molecular weight of 524.55 g/mol. Its IUPAC name is N-(4-piperazin-1-ylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-(4-piperazin-1-ylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118968949 |
| Molecular Formula | C26H27F3N8O |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | N-(4-piperazin-1-ylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1nccc(N2CCNCC2)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CCC1CC2 |
| InChI | InChI=1S/C26H27F3N8O/c27-26(28,29)18-3-1-2-17(16-18)20-4-5-21-23(32-20)37(19-7-12-35(21)13-8-19)25(38)34-24-31-9-6-22(33-24)36-14-10-30-11-15-36/h1-6,9,16,19,30H,7-8,10-15H2,(H,31,33,34,38) |
| InChIKey | OYLQUTCCZQBUBQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |