C28H25F3N6O2 — CID 118968952
N-[3-[2-(aminomethyl)-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118968952) has the molecular formula C28H25F3N6O2 and a molecular weight of 534.54 g/mol. Its IUPAC name is N-[3-[2-(aminomethyl)-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-[3-[2-(aminomethyl)-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118968952 |
| Molecular Formula | C28H25F3N6O2 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | N-[3-[2-(aminomethyl)-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | NCc1ncc(-c2cccc(NC(=O)N3c4nc(-c5cccc(C(F)(F)F)c5)ccc4N4CCC3CC4)c2)o1 |
| InChI | InChI=1S/C28H25F3N6O2/c29-28(30,31)19-5-1-3-17(13-19)22-7-8-23-26(35-22)37(21-9-11-36(23)12-10-21)27(38)34-20-6-2-4-18(14-20)24-16-33-25(15-32)39-24/h1-8,13-14,16,21H,9-12,15,32H2,(H,34,38) |
| InChIKey | HKUSRHWBJGEGDN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |