C21H19F3N6O — CID 118968976
(9S)-N-(1-methylpyrazol-3-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118968976) has the molecular formula C21H19F3N6O and a molecular weight of 428.42 g/mol. Its IUPAC name is (9S)-N-(1-methylpyrazol-3-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(1-methylpyrazol-3-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118968976 |
| Molecular Formula | C21H19F3N6O |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (9S)-N-(1-methylpyrazol-3-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cn1ccc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)n1 |
| InChI | InChI=1S/C21H19F3N6O/c1-28-9-8-18(27-28)26-20(31)30-15-7-10-29(12-15)17-6-5-16(25-19(17)30)13-3-2-4-14(11-13)21(22,23)24/h2-6,8-9,11,15H,7,10,12H2,1H3,(H,26,27,31)/t15-/m0/s1 |
| InChIKey | XIVINKBQZSXLRU-HNNXBMFYSA-N |
| XLogP | 4.13 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |