C24H23F3N6O3 — CID 118968982
(9S)-N-(2,6-dimethoxypyrimidin-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118968982) has the molecular formula C24H23F3N6O3 and a molecular weight of 500.48 g/mol. Its IUPAC name is (9S)-N-(2,6-dimethoxypyrimidin-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(2,6-dimethoxypyrimidin-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118968982 |
| Molecular Formula | C24H23F3N6O3 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | (9S)-N-(2,6-dimethoxypyrimidin-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | COc1cc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CCC[C@H]2C3)nc(OC)n1 |
| InChI | InChI=1S/C24H23F3N6O3/c1-35-20-12-19(29-22(31-20)36-2)30-23(34)33-16-7-4-10-32(13-16)18-9-8-17(28-21(18)33)14-5-3-6-15(11-14)24(25,26)27/h3,5-6,8-9,11-12,16H,4,7,10,13H2,1-2H3,(H,29,30,31,34)/t16-/m0/s1 |
| InChIKey | CHAFBOMOQLNQFM-INIZCTEOSA-N |
| XLogP | 4.60 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |