C24H25ClN6O4 — CID 118969003
(9S)-5-(3-chlorophenyl)-N-[4-(2,3-dihydroxypropoxy)-6-methylpyrimidin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969003) has the molecular formula C24H25ClN6O4 and a molecular weight of 496.96 g/mol. Its IUPAC name is (9S)-5-(3-chlorophenyl)-N-[4-(2,3-dihydroxypropoxy)-6-methylpyrimidin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-(3-chlorophenyl)-N-[4-(2,3-dihydroxypropoxy)-6-methylpyrimidin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969003 |
| Molecular Formula | C24H25ClN6O4 |
| Molecular Weight | 496.96 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (9S)-5-(3-chlorophenyl)-N-[4-(2,3-dihydroxypropoxy)-6-methylpyrimidin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1cc(OCC(O)CO)nc(NC(=O)N2c3nc(-c4cccc(Cl)c4)ccc3N3CC[C@H]2C3)n1 |
| InChI | InChI=1S/C24H25ClN6O4/c1-14-9-21(35-13-18(33)12-32)28-23(26-14)29-24(34)31-17-7-8-30(11-17)20-6-5-19(27-22(20)31)15-3-2-4-16(25)10-15/h2-6,9-10,17-18,32-33H,7-8,11-13H2,1H3,(H,26,28,29,34)/t17-,18?/m0/s1 |
| InChIKey | QJJRSOGPOVCWKJ-ZENAZSQFSA-N |
| XLogP | 2.86 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.96 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |