C23H23FN6O4 — CID 118969013
(9S)-N-[2-(2,3-dihydroxypropoxy)pyrimidin-4-yl]-5-(3-fluorophenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969013) has the molecular formula C23H23FN6O4 and a molecular weight of 466.47 g/mol. Its IUPAC name is (9S)-N-[2-(2,3-dihydroxypropoxy)pyrimidin-4-yl]-5-(3-fluorophenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[2-(2,3-dihydroxypropoxy)pyrimidin-4-yl]-5-(3-fluorophenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969013 |
| Molecular Formula | C23H23FN6O4 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | (9S)-N-[2-(2,3-dihydroxypropoxy)pyrimidin-4-yl]-5-(3-fluorophenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccnc(OCC(O)CO)n1)N1c2nc(-c3cccc(F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C23H23FN6O4/c24-15-3-1-2-14(10-15)18-4-5-19-21(26-18)30(16-7-9-29(19)11-16)23(33)28-20-6-8-25-22(27-20)34-13-17(32)12-31/h1-6,8,10,16-17,31-32H,7,9,11-13H2,(H,25,27,28,33)/t16-,17?/m0/s1 |
| InChIKey | MIDXTIPDKVUELG-BHWOMJMDSA-N |
| XLogP | 2.04 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |