C24H24F3N5OS — CID 118969017
(9S)-N-(4-tert-butyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969017) has the molecular formula C24H24F3N5OS and a molecular weight of 487.55 g/mol. Its IUPAC name is (9S)-N-(4-tert-butyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(4-tert-butyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969017 |
| Molecular Formula | C24H24F3N5OS |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (9S)-N-(4-tert-butyl-1,3-thiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC(C)(C)c1csc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)n1 |
| InChI | InChI=1S/C24H24F3N5OS/c1-23(2,3)19-13-34-21(29-19)30-22(33)32-16-9-10-31(12-16)18-8-7-17(28-20(18)32)14-5-4-6-15(11-14)24(25,26)27/h4-8,11,13,16H,9-10,12H2,1-3H3,(H,29,30,33)/t16-/m0/s1 |
| InChIKey | GNVPWOZEYCHELQ-INIZCTEOSA-N |
| XLogP | 6.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |