C24H24FN5O4 — CID 118969018
(9S)-N-[2-[(2R)-2,3-dihydroxypropoxy]-4-pyridinyl]-5-(3-fluorophenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969018) has the molecular formula C24H24FN5O4 and a molecular weight of 465.49 g/mol. Its IUPAC name is (9S)-N-[2-[(2R)-2,3-dihydroxypropoxy]-4-pyridinyl]-5-(3-fluorophenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[2-[(2R)-2,3-dihydroxypropoxy]-4-pyridinyl]-5-(3-fluorophenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969018 |
| Molecular Formula | C24H24FN5O4 |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | (9S)-N-[2-[(2R)-2,3-dihydroxypropoxy]-4-pyridinyl]-5-(3-fluorophenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccnc(OC[C@H](O)CO)c1)N1c2nc(-c3cccc(F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C24H24FN5O4/c25-16-3-1-2-15(10-16)20-4-5-21-23(28-20)30(18-7-9-29(21)12-18)24(33)27-17-6-8-26-22(11-17)34-14-19(32)13-31/h1-6,8,10-11,18-19,31-32H,7,9,12-14H2,(H,26,27,33)/t18-,19+/m0/s1 |
| InChIKey | JNOCOVAJBLSHAZ-RBUKOAKNSA-N |
| XLogP | 2.65 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |