C25H19F5N4O2 — CID 118969022
(9S)-N-(4-acetyl-2,6-difluorophenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969022) has the molecular formula C25H19F5N4O2 and a molecular weight of 502.44 g/mol. Its IUPAC name is (9S)-N-(4-acetyl-2,6-difluorophenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(4-acetyl-2,6-difluorophenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969022 |
| Molecular Formula | C25H19F5N4O2 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (9S)-N-(4-acetyl-2,6-difluorophenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC(=O)c1cc(F)c(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)c(F)c1 |
| InChI | InChI=1S/C25H19F5N4O2/c1-13(35)15-10-18(26)22(19(27)11-15)32-24(36)34-17-7-8-33(12-17)21-6-5-20(31-23(21)34)14-3-2-4-16(9-14)25(28,29)30/h2-6,9-11,17H,7-8,12H2,1H3,(H,32,36)/t17-/m0/s1 |
| InChIKey | GJYHMWPQJCOPCZ-KRWDZBQOSA-N |
| XLogP | 5.88 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |