C24H18F3N5OS — CID 118969031
(9S)-N-(1,3-benzothiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969031) has the molecular formula C24H18F3N5OS and a molecular weight of 481.50 g/mol. Its IUPAC name is (9S)-N-(1,3-benzothiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(1,3-benzothiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969031 |
| Molecular Formula | C24H18F3N5OS |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (9S)-N-(1,3-benzothiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C24H18F3N5OS/c25-24(26,27)15-5-3-4-14(12-15)17-8-9-19-21(28-17)32(16-10-11-31(19)13-16)23(33)30-22-29-18-6-1-2-7-20(18)34-22/h1-9,12,16H,10-11,13H2,(H,29,30,33)/t16-/m0/s1 |
| InChIKey | HWFTWIZRZDFFHT-INIZCTEOSA-N |
| XLogP | 6.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |