C22H21F3N6O — CID 118969033
(9S)-N-(1,3-dimethylpyrazol-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969033) has the molecular formula C22H21F3N6O and a molecular weight of 442.45 g/mol. Its IUPAC name is (9S)-N-(1,3-dimethylpyrazol-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(1,3-dimethylpyrazol-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969033 |
| Molecular Formula | C22H21F3N6O |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (9S)-N-(1,3-dimethylpyrazol-4-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1nn(C)cc1NC(=O)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C22H21F3N6O/c1-13-18(12-29(2)28-13)27-21(32)31-16-8-9-30(11-16)19-7-6-17(26-20(19)31)14-4-3-5-15(10-14)22(23,24)25/h3-7,10,12,16H,8-9,11H2,1-2H3,(H,27,32)/t16-/m0/s1 |
| InChIKey | JNPQQVLAPWOCGO-INIZCTEOSA-N |
| XLogP | 4.44 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |