C21H17F3N6O2 — CID 118969086
(9S)-N-pyrazin-2-yl-5-[3-(trifluoromethoxy)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969086) has the molecular formula C21H17F3N6O2 and a molecular weight of 442.40 g/mol. Its IUPAC name is (9S)-N-pyrazin-2-yl-5-[3-(trifluoromethoxy)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-pyrazin-2-yl-5-[3-(trifluoromethoxy)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969086 |
| Molecular Formula | C21H17F3N6O2 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | (9S)-N-pyrazin-2-yl-5-[3-(trifluoromethoxy)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cnccn1)N1c2nc(-c3cccc(OC(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C21H17F3N6O2/c22-21(23,24)32-15-3-1-2-13(10-15)16-4-5-17-19(27-16)30(14-6-9-29(17)12-14)20(31)28-18-11-25-7-8-26-18/h1-5,7-8,10-11,14H,6,9,12H2,(H,26,28,31)/t14-/m0/s1 |
| InChIKey | ZGPBAGFZGVHMIM-AWEZNQCLSA-N |
| XLogP | 4.07 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |