C22H19F3N6O3 — CID 118969110
(9S)-N-(6-methoxypyrazin-2-yl)-5-[3-(trifluoromethoxy)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969110) has the molecular formula C22H19F3N6O3 and a molecular weight of 472.43 g/mol. Its IUPAC name is (9S)-N-(6-methoxypyrazin-2-yl)-5-[3-(trifluoromethoxy)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(6-methoxypyrazin-2-yl)-5-[3-(trifluoromethoxy)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969110 |
| Molecular Formula | C22H19F3N6O3 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (9S)-N-(6-methoxypyrazin-2-yl)-5-[3-(trifluoromethoxy)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | COc1cncc(NC(=O)N2c3nc(-c4cccc(OC(F)(F)F)c4)ccc3N3CC[C@H]2C3)n1 |
| InChI | InChI=1S/C22H19F3N6O3/c1-33-19-11-26-10-18(28-19)29-21(32)31-14-7-8-30(12-14)17-6-5-16(27-20(17)31)13-3-2-4-15(9-13)34-22(23,24)25/h2-6,9-11,14H,7-8,12H2,1H3,(H,28,29,32)/t14-/m0/s1 |
| InChIKey | KRNGNGWYXVYXQB-AWEZNQCLSA-N |
| XLogP | 4.08 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |