C22H20FN5O2 — CID 118969118
(9R)-N-(5-fluoro-2-pyridinyl)-5-(3-methoxyphenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969118) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is (9R)-N-(5-fluoro-2-pyridinyl)-5-(3-methoxyphenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9R)-N-(5-fluoro-2-pyridinyl)-5-(3-methoxyphenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969118 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (9R)-N-(5-fluoro-2-pyridinyl)-5-(3-methoxyphenyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | COc1cccc(-c2ccc3c(n2)N(C(=O)Nc2ccc(F)cn2)[C@@H]2CCN3C2)c1 |
| InChI | InChI=1S/C22H20FN5O2/c1-30-17-4-2-3-14(11-17)18-6-7-19-21(25-18)28(16-9-10-27(19)13-16)22(29)26-20-8-5-15(23)12-24-20/h2-8,11-12,16H,9-10,13H2,1H3,(H,24,26,29)/t16-/m1/s1 |
| InChIKey | BEDFGIBEHJHZNC-MRXNPFEDSA-N |
| XLogP | 3.92 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |