C22H20F3N7O2 — CID 118969234
(9S)-N-(6-methoxypyrimidin-4-yl)-5-[5-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969234) has the molecular formula C22H20F3N7O2 and a molecular weight of 471.44 g/mol. Its IUPAC name is (9S)-N-(6-methoxypyrimidin-4-yl)-5-[5-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(6-methoxypyrimidin-4-yl)-5-[5-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969234 |
| Molecular Formula | C22H20F3N7O2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | (9S)-N-(6-methoxypyrimidin-4-yl)-5-[5-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | COc1cc(NC(=O)N2c3nc(-c4cncc(C(F)(F)F)c4)ccc3N3CCC[C@H]2C3)ncn1 |
| InChI | InChI=1S/C22H20F3N7O2/c1-34-19-8-18(27-12-28-19)30-21(33)32-15-3-2-6-31(11-15)17-5-4-16(29-20(17)32)13-7-14(10-26-9-13)22(23,24)25/h4-5,7-10,12,15H,2-3,6,11H2,1H3,(H,27,28,30,33)/t15-/m0/s1 |
| InChIKey | NQOAVQWAJKNBON-HNNXBMFYSA-N |
| XLogP | 3.98 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |