C21H20FN7O2 — CID 118969248
(9S)-5-(5-fluoro-3-pyridinyl)-N-(6-methoxypyrimidin-4-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969248) has the molecular formula C21H20FN7O2 and a molecular weight of 421.44 g/mol. Its IUPAC name is (9S)-5-(5-fluoro-3-pyridinyl)-N-(6-methoxypyrimidin-4-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-(5-fluoro-3-pyridinyl)-N-(6-methoxypyrimidin-4-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969248 |
| Molecular Formula | C21H20FN7O2 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (9S)-5-(5-fluoro-3-pyridinyl)-N-(6-methoxypyrimidin-4-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | COc1cc(NC(=O)N2c3nc(-c4cncc(F)c4)ccc3N3CCC[C@H]2C3)ncn1 |
| InChI | InChI=1S/C21H20FN7O2/c1-31-19-8-18(24-12-25-19)27-21(30)29-15-3-2-6-28(11-15)17-5-4-16(26-20(17)29)13-7-14(22)10-23-9-13/h4-5,7-10,12,15H,2-3,6,11H2,1H3,(H,24,25,27,30)/t15-/m0/s1 |
| InChIKey | APPDNTGDBFKOOQ-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |