C21H21N7O3S — CID 118969259
(9S)-5-[3-(methanesulfonamido)phenyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969259) has the molecular formula C21H21N7O3S and a molecular weight of 451.51 g/mol. Its IUPAC name is (9S)-5-[3-(methanesulfonamido)phenyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-[3-(methanesulfonamido)phenyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969259 |
| Molecular Formula | C21H21N7O3S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (9S)-5-[3-(methanesulfonamido)phenyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2ccc3c(n2)N(C(=O)Nc2cnccn2)[C@H]2CCN3C2)c1 |
| InChI | InChI=1S/C21H21N7O3S/c1-32(30,31)26-15-4-2-3-14(11-15)17-5-6-18-20(24-17)28(16-7-10-27(18)13-16)21(29)25-19-12-22-8-9-23-19/h2-6,8-9,11-12,16,26H,7,10,13H2,1H3,(H,23,25,29)/t16-/m0/s1 |
| InChIKey | OGDIGHVEGLAKGF-INIZCTEOSA-N |
| XLogP | 2.54 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |