C27H22F3N5OS — CID 118969389
(9S)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969389) has the molecular formula C27H22F3N5OS and a molecular weight of 521.57 g/mol. Its IUPAC name is (9S)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969389 |
| Molecular Formula | C27H22F3N5OS |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | (9S)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)N3c4nc(-c5cccc(C(F)(F)F)c5)ccc4N4CC[C@H]3C4)c2)cs1 |
| InChI | InChI=1S/C27H22F3N5OS/c1-16-31-23(15-37-16)18-5-3-7-20(13-18)32-26(36)35-21-10-11-34(14-21)24-9-8-22(33-25(24)35)17-4-2-6-19(12-17)27(28,29)30/h2-9,12-13,15,21H,10-11,14H2,1H3,(H,32,36)/t21-/m0/s1 |
| InChIKey | OHGZOOXYDBLVFQ-NRFANRHFSA-N |
| XLogP | 6.83 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |