C25H21F3N4O3 — CID 118969395
methyl 3-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]benzoate (PubChem CID 118969395) has the molecular formula C25H21F3N4O3 and a molecular weight of 482.46 g/mol. Its IUPAC name is methyl 3-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 118969395 |
| Molecular Formula | C25H21F3N4O3 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | methyl 3-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C25H21F3N4O3/c1-35-23(33)16-5-3-7-18(13-16)29-24(34)32-19-10-11-31(14-19)21-9-8-20(30-22(21)32)15-4-2-6-17(12-15)25(26,27)28/h2-9,12-13,19H,10-11,14H2,1H3,(H,29,34)/t19-/m0/s1 |
| InChIKey | QVVMTFLCIARNBX-IBGZPJMESA-N |
| XLogP | 5.18 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |