C25H21F3N4O2 — CID 118969432
(9S)-N-(4-acetylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969432) has the molecular formula C25H21F3N4O2 and a molecular weight of 466.46 g/mol. Its IUPAC name is (9S)-N-(4-acetylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(4-acetylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969432 |
| Molecular Formula | C25H21F3N4O2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (9S)-N-(4-acetylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)cc1 |
| InChI | InChI=1S/C25H21F3N4O2/c1-15(33)16-5-7-19(8-6-16)29-24(34)32-20-11-12-31(14-20)22-10-9-21(30-23(22)32)17-3-2-4-18(13-17)25(26,27)28/h2-10,13,20H,11-12,14H2,1H3,(H,29,34)/t20-/m0/s1 |
| InChIKey | CJXULGWTFYFASC-FQEVSTJZSA-N |
| XLogP | 5.60 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |