C28H27F3N4O2 — CID 118969478
(9S)-N-(3-pentanoylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969478) has the molecular formula C28H27F3N4O2 and a molecular weight of 508.54 g/mol. Its IUPAC name is (9S)-N-(3-pentanoylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(3-pentanoylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969478 |
| Molecular Formula | C28H27F3N4O2 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | (9S)-N-(3-pentanoylphenyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CCCCC(=O)c1cccc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C28H27F3N4O2/c1-2-3-10-25(36)19-7-5-9-21(16-19)32-27(37)35-22-13-14-34(17-22)24-12-11-23(33-26(24)35)18-6-4-8-20(15-18)28(29,30)31/h4-9,11-12,15-16,22H,2-3,10,13-14,17H2,1H3,(H,32,37)/t22-/m0/s1 |
| InChIKey | YUSFDXOCSNGVNY-QFIPXVFZSA-N |
| XLogP | 6.77 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |