C27H25F3N4O2 — CID 118969480
(9S)-N-[3-(2-methylpropanoyl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969480) has the molecular formula C27H25F3N4O2 and a molecular weight of 494.52 g/mol. Its IUPAC name is (9S)-N-[3-(2-methylpropanoyl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[3-(2-methylpropanoyl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969480 |
| Molecular Formula | C27H25F3N4O2 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (9S)-N-[3-(2-methylpropanoyl)phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC(C)C(=O)c1cccc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C27H25F3N4O2/c1-16(2)24(35)18-6-4-8-20(14-18)31-26(36)34-21-11-12-33(15-21)23-10-9-22(32-25(23)34)17-5-3-7-19(13-17)27(28,29)30/h3-10,13-14,16,21H,11-12,15H2,1-2H3,(H,31,36)/t21-/m0/s1 |
| InChIKey | HHAICFPIMVTXBG-NRFANRHFSA-N |
| XLogP | 6.24 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |