C26H27F3N8O — CID 118969482
(9S)-N-[4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969482) has the molecular formula C26H27F3N8O and a molecular weight of 524.55 g/mol. Its IUPAC name is (9S)-N-[4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969482 |
| Molecular Formula | C26H27F3N8O |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | (9S)-N-[4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CN1CCN(c2ccnc(NC(=O)N3c4nc(-c5cccc(C(F)(F)F)c5)ccc4N4CC[C@H]3C4)n2)CC1 |
| InChI | InChI=1S/C26H27F3N8O/c1-34-11-13-35(14-12-34)22-7-9-30-24(32-22)33-25(38)37-19-8-10-36(16-19)21-6-5-20(31-23(21)37)17-3-2-4-18(15-17)26(27,28)29/h2-7,9,15,19H,8,10-14,16H2,1H3,(H,30,32,33,38)/t19-/m0/s1 |
| InChIKey | UMENNENHRZVQQO-IBGZPJMESA-N |
| XLogP | 3.94 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |