C11H19N2+ — CID 11896969
2-[(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]acetonitrile (PubChem CID 11896969) has the molecular formula C11H19N2+ and a molecular weight of 179.29 g/mol. Its IUPAC name is 2-[(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]acetonitrile.
| Compound Name | 2-[(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]acetonitrile |
|---|---|
| PubChem CID | 11896969 |
| Molecular Formula | C11H19N2+ |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | 2-[(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]acetonitrile |
| SMILES | N#CC[C@H]1CCC[NH+]2CCCC[C@@H]12 |
| InChI | InChI=1S/C11H18N2/c12-7-6-10-4-3-9-13-8-2-1-5-11(10)13/h10-11H,1-6,8-9H2/p+1/t10-,11+/m1/s1 |
| InChIKey | OIQLDCGCWJGORH-MNOVXSKESA-O |
| XLogP | 0.75 |
| TPSA | 28.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |