About 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine
5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine (PubChem CID 118969980) has the molecular formula C13H23N3
and a molecular weight of 221.35 g/mol. Its IUPAC name is 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine |
| PubChem CID | 118969980 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine |
| SMILES | CC(C)C1CCN(C2=CNC(N)C=C2)CC1 |
| InChI | InChI=1S/C13H23N3/c1-10(2)11-5-7-16(8-6-11)12-3-4-13(14)15-9-12/h3-4,9-11,13,15H,5-8,14H2,1-2H3 |
| InChIKey | QXIVLGALJBUMSD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine?
The IUPAC name of 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine (CID 118969980) is 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine.
What is the SMILES notation for 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine?
The canonical SMILES for 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine is CC(C)C1CCN(C2=CNC(N)C=C2)CC1.
What is the InChIKey of 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine?
The InChIKey is QXIVLGALJBUMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3/c1-10(2)11-5-7-16(8-6-11)12-3-4-13(14)15-9-12/h3-4,9-11,13,15H,5-8,14H2,1-2H3.
What are the key properties of 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine?
5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine has a molecular weight of 221.35 g/mol, XLogP of 1.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-propan-2-ylpiperidin-1-yl)-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 118969980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).