C12H14ClN3 — CID 118970084
6-[(2E,4E)-5-chloro-6-methylhepta-2,4,6-trien-3-yl]pyrazin-2-amine (PubChem CID 118970084) has the molecular formula C12H14ClN3 and a molecular weight of 235.72 g/mol. Its IUPAC name is 6-[(2E,4E)-5-chloro-6-methylhepta-2,4,6-trien-3-yl]pyrazin-2-amine.
| Compound Name | 6-[(2E,4E)-5-chloro-6-methylhepta-2,4,6-trien-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 118970084 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 6-[(2E,4E)-5-chloro-6-methylhepta-2,4,6-trien-3-yl]pyrazin-2-amine |
| SMILES | C=C(C)/C(Cl)=C\C(=C/C)c1cncc(N)n1 |
| InChI | InChI=1S/C12H14ClN3/c1-4-9(5-10(13)8(2)3)11-6-15-7-12(14)16-11/h4-7H,2H2,1,3H3,(H2,14,16)/b9-4+,10-5+ |
| InChIKey | WNDUNPNBQPMOFU-LUZURFALSA-N |
| XLogP | 3.16 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|