About (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine
(E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine (PubChem CID 118970152) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine |
| PubChem CID | 118970152 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine |
| SMILES | N/C=C(\CN)C1C=CC=CN1 |
| InChI | InChI=1S/C8H13N3/c9-5-7(6-10)8-3-1-2-4-11-8/h1-5,8,11H,6,9-10H2/b7-5+ |
| InChIKey | ZPVLKCIXAMXEDR-FNORWQNLSA-N |
| XLogP | -0.17 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine?
The IUPAC name of (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine (CID 118970152) is (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine.
What is the SMILES notation for (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine?
The canonical SMILES for (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine is N/C=C(\CN)C1C=CC=CN1.
What is the InChIKey of (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine?
The InChIKey is ZPVLKCIXAMXEDR-FNORWQNLSA-N. The full InChI is InChI=1S/C8H13N3/c9-5-7(6-10)8-3-1-2-4-11-8/h1-5,8,11H,6,9-10H2/b7-5+.
What are the key properties of (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine?
(E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine has a molecular weight of 151.21 g/mol, XLogP of -0.17, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(1,2-dihydropyridin-2-yl)prop-1-ene-1,3-diamine is sourced from PubChem (CID 118970152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).