About 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine
6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine (PubChem CID 118970182) has the molecular formula C15H16F2N4
and a molecular weight of 290.32 g/mol. Its IUPAC name is 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine |
| PubChem CID | 118970182 |
| Molecular Formula | C15H16F2N4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine |
| SMILES | NC1C=CC=C(c2ccc(N3CC4C(C3)C4(F)F)nc2)N1 |
| InChI | InChI=1S/C15H16F2N4/c16-15(17)10-7-21(8-11(10)15)14-5-4-9(6-19-14)12-2-1-3-13(18)20-12/h1-6,10-11,13,20H,7-8,18H2 |
| InChIKey | KAHQINFWUWFFQM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine?
The IUPAC name of 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine (CID 118970182) is 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine.
What is the SMILES notation for 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine?
The canonical SMILES for 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine is NC1C=CC=C(c2ccc(N3CC4C(C3)C4(F)F)nc2)N1.
What is the InChIKey of 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine?
The InChIKey is KAHQINFWUWFFQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N4/c16-15(17)10-7-21(8-11(10)15)14-5-4-9(6-19-14)12-2-1-3-13(18)20-12/h1-6,10-11,13,20H,7-8,18H2.
What are the key properties of 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine?
6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine has a molecular weight of 290.32 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 118970182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).