C26H31N3O2 — CID 118970656
3-[2-amino-6-(2-methoxyphenyl)quinolin-3-yl]-N-(cyclohexylmethyl)propanamide (PubChem CID 118970656) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 3-[2-amino-6-(2-methoxyphenyl)quinolin-3-yl]-N-(cyclohexylmethyl)propanamide.
| Compound Name | 3-[2-amino-6-(2-methoxyphenyl)quinolin-3-yl]-N-(cyclohexylmethyl)propanamide |
|---|---|
| PubChem CID | 118970656 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 3-[2-amino-6-(2-methoxyphenyl)quinolin-3-yl]-N-(cyclohexylmethyl)propanamide |
| SMILES | COc1ccccc1-c1ccc2nc(N)c(CCC(=O)NCC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C26H31N3O2/c1-31-24-10-6-5-9-22(24)19-11-13-23-21(15-19)16-20(26(27)29-23)12-14-25(30)28-17-18-7-3-2-4-8-18/h5-6,9-11,13,15-16,18H,2-4,7-8,12,14,17H2,1H3,(H2,27,29)(H,28,30) |
| InChIKey | LLOBZEJFRNFWJK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |