C17H24N2O2S — CID 118970984
ethyl 1,5,5,7,7-pentamethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate (PubChem CID 118970984) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is ethyl 1,5,5,7,7-pentamethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate.
| Compound Name | ethyl 1,5,5,7,7-pentamethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
|---|---|
| PubChem CID | 118970984 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | ethyl 1,5,5,7,7-pentamethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc2sc3c(n2c1C)CC(C)(C)CC3(C)C |
| InChI | InChI=1S/C17H24N2O2S/c1-7-21-14(20)12-10(2)19-11-8-16(3,4)9-17(5,6)13(11)22-15(19)18-12/h7-9H2,1-6H3 |
| InChIKey | CIRAUJSGQPBSEB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |