C18H32N2O2 — CID 11897115
(2S,4S,5S)-4-[2-[(2R,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-4-yl]ethynyl]-1,2,5-trimethylpiperidin-4-ol (PubChem CID 11897115) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is (2S,4S,5S)-4-[2-[(2R,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-4-yl]ethynyl]-1,2,5-trimethylpiperidin-4-ol.
| Compound Name | (2S,4S,5S)-4-[2-[(2R,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-4-yl]ethynyl]-1,2,5-trimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 11897115 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | (2S,4S,5S)-4-[2-[(2R,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-4-yl]ethynyl]-1,2,5-trimethylpiperidin-4-ol |
| SMILES | C[C@@H]1C[C@@](O)(C#C[C@]2(O)C[C@H](C)N(C)C[C@@H]2C)[C@H](C)CN1C |
| InChI | InChI=1S/C18H32N2O2/c1-13-11-19(5)15(3)9-17(13,21)7-8-18(22)10-16(4)20(6)12-14(18)2/h13-16,21-22H,9-12H2,1-6H3/t13-,14+,15-,16+,17-,18-/m0/s1 |
| InChIKey | ZBZQUXUOLGJMQY-RFSXOUPVSA-N |
| XLogP | 1.17 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|