C9H11ClO — CID 118971154
(2E,4E)-6-chloro-2,4-dimethylhepta-2,4,6-trienal (PubChem CID 118971154) has the molecular formula C9H11ClO and a molecular weight of 170.64 g/mol. Its IUPAC name is (2E,4E)-6-chloro-2,4-dimethylhepta-2,4,6-trienal.
| Compound Name | (2E,4E)-6-chloro-2,4-dimethylhepta-2,4,6-trienal |
|---|---|
| PubChem CID | 118971154 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | (2E,4E)-6-chloro-2,4-dimethylhepta-2,4,6-trienal |
| SMILES | C=C(Cl)/C=C(C)/C=C(\C)C=O |
| InChI | InChI=1S/C9H11ClO/c1-7(5-9(3)10)4-8(2)6-11/h4-6H,3H2,1-2H3/b7-5+,8-4+ |
| InChIKey | UQDRYLWVUUKWOY-JBVHCYJISA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|