C18H22N2O2S — CID 118971291
ethyl 1-ethynyl-5,5,7,7-tetramethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate (PubChem CID 118971291) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is ethyl 1-ethynyl-5,5,7,7-tetramethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate.
| Compound Name | ethyl 1-ethynyl-5,5,7,7-tetramethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
|---|---|
| PubChem CID | 118971291 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | ethyl 1-ethynyl-5,5,7,7-tetramethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
| SMILES | C#Cc1c(C(=O)OCC)nc2sc3c(n12)CC(C)(C)CC3(C)C |
| InChI | InChI=1S/C18H22N2O2S/c1-7-11-13(15(21)22-8-2)19-16-20(11)12-9-17(3,4)10-18(5,6)14(12)23-16/h1H,8-10H2,2-6H3 |
| InChIKey | DUHQOELSPNUGFW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|