About N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine
N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 118971370) has the molecular formula C11H21ClN4
and a molecular weight of 244.77 g/mol. Its IUPAC name is N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine |
| PubChem CID | 118971370 |
| Molecular Formula | C11H21ClN4 |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CCCn1cnc(Cl)c1CN(C)CCNC |
| InChI | InChI=1S/C11H21ClN4/c1-4-6-16-9-14-11(12)10(16)8-15(3)7-5-13-2/h9,13H,4-8H2,1-3H3 |
| InChIKey | YIIFXRPMARONFR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine?
The IUPAC name of N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine (CID 118971370) is N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine?
The canonical SMILES for N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine is CCCn1cnc(Cl)c1CN(C)CCNC.
What is the InChIKey of N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine?
The InChIKey is YIIFXRPMARONFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21ClN4/c1-4-6-16-9-14-11(12)10(16)8-15(3)7-5-13-2/h9,13H,4-8H2,1-3H3.
What are the key properties of N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine?
N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine has a molecular weight of 244.77 g/mol, XLogP of 1.60, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(5-chloro-3-propylimidazol-4-yl)methyl]-N,N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 118971370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).