About (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine
(E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine (PubChem CID 118971587) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine |
| PubChem CID | 118971587 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine |
| SMILES | C/C=N/N/C=C/CN(C)C |
| InChI | InChI=1S/C7H15N3/c1-4-8-9-6-5-7-10(2)3/h4-6,9H,7H2,1-3H3/b6-5+,8-4+ |
| InChIKey | TYNRBLWIGLJYFN-PTFSRLPTSA-N |
| XLogP | 0.66 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine?
The IUPAC name of (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine (CID 118971587) is (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine.
What is the SMILES notation for (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine?
The canonical SMILES for (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine is C/C=N/N/C=C/CN(C)C.
What is the InChIKey of (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine?
The InChIKey is TYNRBLWIGLJYFN-PTFSRLPTSA-N. The full InChI is InChI=1S/C7H15N3/c1-4-8-9-6-5-7-10(2)3/h4-6,9H,7H2,1-3H3/b6-5+,8-4+.
What are the key properties of (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine?
(E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine has a molecular weight of 141.22 g/mol, XLogP of 0.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(E)-ethylideneamino]-N',N'-dimethylprop-1-ene-1,3-diamine is sourced from PubChem (CID 118971587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).