C30H46O5 — CID 118972077
(1S,6S)-4-(2,5-dihydrofuran-3-yl)-6-[(2S,4R)-4-ethenyl-3,4,6,6-tetramethyl-5-(2-prop-1-en-2-yloxyethyl)oct-7-en-2-yl]-5,5-dimethyl-3,7-dioxabicyclo[4.1.0]heptan-2-one (PubChem CID 118972077) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is (1S,6S)-4-(2,5-dihydrofuran-3-yl)-6-[(2S,4R)-4-ethenyl-3,4,6,6-tetramethyl-5-(2-prop-1-en-2-yloxyethyl)oct-7-en-2-yl]-5,5-dimethyl-3,7-dioxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1S,6S)-4-(2,5-dihydrofuran-3-yl)-6-[(2S,4R)-4-ethenyl-3,4,6,6-tetramethyl-5-(2-prop-1-en-2-yloxyethyl)oct-7-en-2-yl]-5,5-dimethyl-3,7-dioxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 118972077 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (1S,6S)-4-(2,5-dihydrofuran-3-yl)-6-[(2S,4R)-4-ethenyl-3,4,6,6-tetramethyl-5-(2-prop-1-en-2-yloxyethyl)oct-7-en-2-yl]-5,5-dimethyl-3,7-dioxabicyclo[4.1.0]heptan-2-one |
| SMILES | C=CC(C)(C)C(CCOC(=C)C)[C@](C)(C=C)C(C)[C@H](C)[C@@]12O[C@@H]1C(=O)OC(C1=CCOC1)C2(C)C |
| InChI | InChI=1S/C30H46O5/c1-12-27(7,8)23(15-17-33-19(3)4)29(11,13-2)20(5)21(6)30-25(35-30)26(31)34-24(28(30,9)10)22-14-16-32-18-22/h12-14,20-21,23-25H,1-3,15-18H2,4-11H3/t20?,21-,23?,24?,25+,29+,30+/m0/s1 |
| InChIKey | NGZNIKAGEFBRTF-PZTSTPAQSA-N |
| XLogP | 6.27 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|